C26H17F3N2O2S — CID 88912140
2-[4-[[(5Z)-5-[[4-methyl-3-(trifluoromethyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]phenyl]benzonitrile (PubChem CID 88912140) has the molecular formula C26H17F3N2O2S and a molecular weight of 478.50 g/mol. Its IUPAC name is 2-[4-[[(5Z)-5-[[4-methyl-3-(trifluoromethyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[[(5Z)-5-[[4-methyl-3-(trifluoromethyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 88912140 |
| Molecular Formula | C26H17F3N2O2S |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-[4-[[(5Z)-5-[[4-methyl-3-(trifluoromethyl)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]phenyl]benzonitrile |
| SMILES | Cc1ccc(/C=C2\SC(=O)N(Cc3ccc(-c4ccccc4C#N)cc3)C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C26H17F3N2O2S/c1-16-6-7-18(12-22(16)26(27,28)29)13-23-24(32)31(25(33)34-23)15-17-8-10-19(11-9-17)21-5-3-2-4-20(21)14-30/h2-13H,15H2,1H3/b23-13- |
| InChIKey | GAPNCTXCKDARPH-QRVIBDJDSA-N |
| XLogP | 6.79 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|