C17H27NO2 — CID 88918174
ethyl 4-methyl-1-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]piperidine-4-carboxylate (PubChem CID 88918174) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is ethyl 4-methyl-1-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]piperidine-4-carboxylate.
| Compound Name | ethyl 4-methyl-1-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 88918174 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | ethyl 4-methyl-1-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]piperidine-4-carboxylate |
| SMILES | C=C/C=C\C=C(/C)CN1CCC(C)(C(=O)OCC)CC1 |
| InChI | InChI=1S/C17H27NO2/c1-5-7-8-9-15(3)14-18-12-10-17(4,11-13-18)16(19)20-6-2/h5,7-9H,1,6,10-14H2,2-4H3/b8-7-,15-9+ |
| InChIKey | YZYFBJPVYXFIKK-USTJKHOZSA-N |
| XLogP | 3.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|