C17H15N3O6 — CID 8892603
(8S)-8-(2,3-dimethoxyphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione (PubChem CID 8892603) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is (8S)-8-(2,3-dimethoxyphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione.
| Compound Name | (8S)-8-(2,3-dimethoxyphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione |
|---|---|
| PubChem CID | 8892603 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (8S)-8-(2,3-dimethoxyphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione |
| SMILES | COc1cccc([C@@H]2C3=C(COC3=O)Nc3[nH]c(=O)[nH]c(=O)c32)c1OC |
| InChI | InChI=1S/C17H15N3O6/c1-24-9-5-3-4-7(13(9)25-2)10-11-8(6-26-16(11)22)18-14-12(10)15(21)20-17(23)19-14/h3-5,10H,6H2,1-2H3,(H3,18,19,20,21,23)/t10-/m1/s1 |
| InChIKey | DHCWXPCEOVNNGA-SNVBAGLBSA-N |
| XLogP | 0.45 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |