C26H28N6O — CID 88933067
1-[6-(4-methoxyphenyl)-3-methyl-4-(4-piperazin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]ethanimine (PubChem CID 88933067) has the molecular formula C26H28N6O and a molecular weight of 440.55 g/mol. Its IUPAC name is 1-[6-(4-methoxyphenyl)-3-methyl-4-(4-piperazin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]ethanimine.
| Compound Name | 1-[6-(4-methoxyphenyl)-3-methyl-4-(4-piperazin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]ethanimine |
|---|---|
| PubChem CID | 88933067 |
| Molecular Formula | C26H28N6O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 1-[6-(4-methoxyphenyl)-3-methyl-4-(4-piperazin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]ethanimine |
| SMILES | [H]/N=C(\C)c1c(-c2ccc(OC)cc2)nc2n[nH]c(C)c2c1-c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C26H28N6O/c1-16(27)22-24(18-4-8-20(9-5-18)32-14-12-28-13-15-32)23-17(2)30-31-26(23)29-25(22)19-6-10-21(33-3)11-7-19/h4-11,27-28H,12-15H2,1-3H3,(H,29,30,31)/b27-16+ |
| InChIKey | XSCSODUAMBODLA-JVWAILMASA-N |
| XLogP | 4.41 |
| TPSA | 89.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|