C28H60N4O5Si2+2 — CID 88934860
butyl-[2-[3-[[3-[[2-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]acetyl]amino]propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-2-oxoethyl]-dimethylazanium (PubChem CID 88934860) has the molecular formula C28H60N4O5Si2+2 and a molecular weight of 588.98 g/mol. Its IUPAC name is butyl-[2-[3-[[3-[[2-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]acetyl]amino]propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-2-oxoethyl]-dimethylazanium.
| Compound Name | butyl-[2-[3-[[3-[[2-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]acetyl]amino]propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 88934860 |
| Molecular Formula | C28H60N4O5Si2+2 |
| Molecular Weight | 588.98 g/mol |
| Exact Mass | 588.41 |
| IUPAC Name | butyl-[2-[3-[[3-[[2-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]acetyl]amino]propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-2-oxoethyl]-dimethylazanium |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)CC(=O)NCCC[Si](C)(C)O[Si](C)(C)CCCNC(=O)C[N+](C)(C)CCCC |
| InChI | InChI=1S/C28H58N4O5Si2/c1-12-13-18-31(4,5)23-26(33)29-16-14-21-38(8,9)37-39(10,11)22-15-17-30-27(34)24-32(6,7)19-20-36-28(35)25(2)3/h2,12-24H2,1,3-11H3/p+2 |
| InChIKey | RWVAFJGLNSQTFY-UHFFFAOYSA-P |
| XLogP | 3.50 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.98 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|