C28H57N2O5Si2+ — CID 58308899
4-[[4-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]butyl-dimethylsilyl]oxy-dimethylsilyl]butyl-methanidyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 58308899) has the molecular formula C28H57N2O5Si2+ and a molecular weight of 557.95 g/mol. Its IUPAC name is 4-[[4-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]butyl-dimethylsilyl]oxy-dimethylsilyl]butyl-methanidyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | 4-[[4-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]butyl-dimethylsilyl]oxy-dimethylsilyl]butyl-methanidyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 58308899 |
| Molecular Formula | C28H57N2O5Si2+ |
| Molecular Weight | 557.95 g/mol |
| Exact Mass | 557.38 |
| IUPAC Name | 4-[[4-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]butyl-dimethylsilyl]oxy-dimethylsilyl]butyl-methanidyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OCC[N+]([CH2-])(C)CCCC[Si](C)(C)O[Si](C)(C)CCCC[N+](C)(C)CCOC(=O)C(=C)C |
| InChI | InChI=1S/C28H57N2O5Si2/c1-25(2)27(31)33-21-19-29(5,6)17-13-15-23-36(9,10)35-37(11,12)24-16-14-18-30(7,8)20-22-34-28(32)26(3)4/h1,3,5,13-24H2,2,4,6-12H3/q+1 |
| InChIKey | IERSHLOKOBRZIK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.95 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|