C23H48N3O5Si2+ — CID 89221817
[2-[3-[[dimethyl-[3-(propanoylamino)propyl]silyl]oxy-dimethylsilyl]propylamino]-2-oxoethyl]-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 89221817) has the molecular formula C23H48N3O5Si2+ and a molecular weight of 502.83 g/mol. Its IUPAC name is [2-[3-[[dimethyl-[3-(propanoylamino)propyl]silyl]oxy-dimethylsilyl]propylamino]-2-oxoethyl]-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | [2-[3-[[dimethyl-[3-(propanoylamino)propyl]silyl]oxy-dimethylsilyl]propylamino]-2-oxoethyl]-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 89221817 |
| Molecular Formula | C23H48N3O5Si2+ |
| Molecular Weight | 502.83 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | [2-[3-[[dimethyl-[3-(propanoylamino)propyl]silyl]oxy-dimethylsilyl]propylamino]-2-oxoethyl]-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)CC(=O)NCCC[Si](C)(C)O[Si](C)(C)CCCNC(=O)CC |
| InChI | InChI=1S/C23H47N3O5Si2/c1-10-21(27)24-13-11-17-32(6,7)31-33(8,9)18-12-14-25-22(28)19-26(4,5)15-16-30-23(29)20(2)3/h2,10-19H2,1,3-9H3,(H-,24,25,27,28)/p+1 |
| InChIKey | LDWSRMHDJPYIOA-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.83 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|