C14H18F6O9 — CID 88936700
bis(2,2,2-trifluoroethyl) 2-[[(3S,4S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]propanedioate (PubChem CID 88936700) has the molecular formula C14H18F6O9 and a molecular weight of 444.28 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2-[[(3S,4S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]propanedioate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2-[[(3S,4S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 88936700 |
| Molecular Formula | C14H18F6O9 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2-[[(3S,4S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]propanedioate |
| SMILES | CO[C@H]1OC(CC(C(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F)[C@@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C14H18F6O9/c1-26-12-9(23)8(22)7(21)6(29-12)2-5(10(24)27-3-13(15,16)17)11(25)28-4-14(18,19)20/h5-9,12,21-23H,2-4H2,1H3/t6?,7-,8+,9?,12+/m1/s1 |
| InChIKey | ORFSYGLTIDLOHR-BOVMPRCPSA-N |
| XLogP | -0.34 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|