C10H10BrF3O3S — CID 88937686
4-bromo-2,3,6-trimethyl-5-(trifluoromethylsulfonyl)phenol (PubChem CID 88937686) has the molecular formula C10H10BrF3O3S and a molecular weight of 347.15 g/mol. Its IUPAC name is 4-bromo-2,3,6-trimethyl-5-(trifluoromethylsulfonyl)phenol.
| Compound Name | 4-bromo-2,3,6-trimethyl-5-(trifluoromethylsulfonyl)phenol |
|---|---|
| PubChem CID | 88937686 |
| Molecular Formula | C10H10BrF3O3S |
| Molecular Weight | 347.15 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | 4-bromo-2,3,6-trimethyl-5-(trifluoromethylsulfonyl)phenol |
| SMILES | Cc1c(C)c(Br)c(S(=O)(=O)C(F)(F)F)c(C)c1O |
| InChI | InChI=1S/C10H10BrF3O3S/c1-4-5(2)8(15)6(3)9(7(4)11)18(16,17)10(12,13)14/h15H,1-3H3 |
| InChIKey | LUDPTXACPZWKSN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.15 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |