C17H21N — CID 88952691
(2E,6Z)-3,6-dimethyl-8-(2-phenylethyl)-4,5-dihydroazocine (PubChem CID 88952691) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is (2E,6Z)-3,6-dimethyl-8-(2-phenylethyl)-4,5-dihydroazocine.
| Compound Name | (2E,6Z)-3,6-dimethyl-8-(2-phenylethyl)-4,5-dihydroazocine |
|---|---|
| PubChem CID | 88952691 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (2E,6Z)-3,6-dimethyl-8-(2-phenylethyl)-4,5-dihydroazocine |
| SMILES | C/C1=C/N=C(CCc2ccccc2)\C=C(\C)CC1 |
| InChI | InChI=1S/C17H21N/c1-14-8-9-15(2)13-18-17(12-14)11-10-16-6-4-3-5-7-16/h3-7,12-13H,8-11H2,1-2H3/b14-12-,15-13-,18-17- |
| InChIKey | OSFHCAUWUIIAFG-PRJAHTBZSA-N |
| XLogP | 4.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |