C30H30N2O3 — CID 88953979
(5Z)-3-acetyl-1-benzyl-5-[(2E)-2-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)ethylidene]-4-methylpyridine-2,6-dione (PubChem CID 88953979) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is (5Z)-3-acetyl-1-benzyl-5-[(2E)-2-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)ethylidene]-4-methylpyridine-2,6-dione.
| Compound Name | (5Z)-3-acetyl-1-benzyl-5-[(2E)-2-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)ethylidene]-4-methylpyridine-2,6-dione |
|---|---|
| PubChem CID | 88953979 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | (5Z)-3-acetyl-1-benzyl-5-[(2E)-2-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)ethylidene]-4-methylpyridine-2,6-dione |
| SMILES | CC(=O)C1=C(C)/C(=C/C=C2/N3CCCc4cccc(c43)C2(C)C)C(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C30H30N2O3/c1-19-23(28(34)32(29(35)26(19)20(2)33)18-21-10-6-5-7-11-21)15-16-25-30(3,4)24-14-8-12-22-13-9-17-31(25)27(22)24/h5-8,10-12,14-16H,9,13,17-18H2,1-4H3/b23-15-,25-16+ |
| InChIKey | XSRKGWOSCPNMOA-DDDAEUOASA-N |
| XLogP | 5.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|