C22H28N2O — CID 88960814
2,4-ditert-butyl-6-(3H-cinnolin-2-yl)phenol (PubChem CID 88960814) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(3H-cinnolin-2-yl)phenol.
| Compound Name | 2,4-ditert-butyl-6-(3H-cinnolin-2-yl)phenol |
|---|---|
| PubChem CID | 88960814 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 2,4-ditert-butyl-6-(3H-cinnolin-2-yl)phenol |
| SMILES | CC(C)(C)c1cc(N2CC=c3ccccc3=N2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H28N2O/c1-21(2,3)16-13-17(22(4,5)6)20(25)19(14-16)24-12-11-15-9-7-8-10-18(15)23-24/h7-11,13-14,25H,12H2,1-6H3 |
| InChIKey | DZJLRGMUZLVJGI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |