C22H23ClSi — CID 88962443
chloro-(2,5-dimethylphenyl)-(3,5-dimethylphenyl)-phenylsilane (PubChem CID 88962443) has the molecular formula C22H23ClSi and a molecular weight of 350.97 g/mol. Its IUPAC name is chloro-(2,5-dimethylphenyl)-(3,5-dimethylphenyl)-phenylsilane.
| Compound Name | chloro-(2,5-dimethylphenyl)-(3,5-dimethylphenyl)-phenylsilane |
|---|---|
| PubChem CID | 88962443 |
| Molecular Formula | C22H23ClSi |
| Molecular Weight | 350.97 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | chloro-(2,5-dimethylphenyl)-(3,5-dimethylphenyl)-phenylsilane |
| SMILES | Cc1cc(C)cc([Si](Cl)(c2ccccc2)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C22H23ClSi/c1-16-10-11-19(4)22(15-16)24(23,20-8-6-5-7-9-20)21-13-17(2)12-18(3)14-21/h5-15H,1-4H3 |
| InChIKey | JYPGRHRPZYUICG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.97 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|