C20H24ClN7O2 — CID 88964526
3,5-diamino-6-chloro-N-[(5S)-5-[(E)-2-methyl-4-phenylmethoxybut-1-enyl]-4,5-dihydro-1H-imidazol-2-yl]pyrazine-2-carboxamide (PubChem CID 88964526) has the molecular formula C20H24ClN7O2 and a molecular weight of 429.91 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[(5S)-5-[(E)-2-methyl-4-phenylmethoxybut-1-enyl]-4,5-dihydro-1H-imidazol-2-yl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[(5S)-5-[(E)-2-methyl-4-phenylmethoxybut-1-enyl]-4,5-dihydro-1H-imidazol-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88964526 |
| Molecular Formula | C20H24ClN7O2 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[(5S)-5-[(E)-2-methyl-4-phenylmethoxybut-1-enyl]-4,5-dihydro-1H-imidazol-2-yl]pyrazine-2-carboxamide |
| SMILES | C/C(=C\[C@H]1CN=C(NC(=O)c2nc(Cl)c(N)nc2N)N1)CCOCc1ccccc1 |
| InChI | InChI=1S/C20H24ClN7O2/c1-12(7-8-30-11-13-5-3-2-4-6-13)9-14-10-24-20(25-14)28-19(29)15-17(22)27-18(23)16(21)26-15/h2-6,9,14H,7-8,10-11H2,1H3,(H4,22,23,27)(H2,24,25,28,29)/b12-9+/t14-/m0/s1 |
| InChIKey | YSCJIMFDUMRFFD-TZIYXEQSSA-N |
| XLogP | 1.91 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|