C21H28ClN7O2 — CID 74942409
3,5-diamino-6-chloro-N-[5-(2,2-dimethyl-4-phenylmethoxybutyl)-4,5-dihydro-1H-imidazol-2-yl]pyrazine-2-carboxamide (PubChem CID 74942409) has the molecular formula C21H28ClN7O2 and a molecular weight of 445.96 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[5-(2,2-dimethyl-4-phenylmethoxybutyl)-4,5-dihydro-1H-imidazol-2-yl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[5-(2,2-dimethyl-4-phenylmethoxybutyl)-4,5-dihydro-1H-imidazol-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 74942409 |
| Molecular Formula | C21H28ClN7O2 |
| Molecular Weight | 445.96 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[5-(2,2-dimethyl-4-phenylmethoxybutyl)-4,5-dihydro-1H-imidazol-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(C)(CCOCc1ccccc1)CC1CN=C(NC(=O)c2nc(Cl)c(N)nc2N)N1 |
| InChI | InChI=1S/C21H28ClN7O2/c1-21(2,8-9-31-12-13-6-4-3-5-7-13)10-14-11-25-20(26-14)29-19(30)15-17(23)28-18(24)16(22)27-15/h3-7,14H,8-12H2,1-2H3,(H4,23,24,28)(H2,25,26,29,30) |
| InChIKey | MQGPRLJEFTXQDH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.96 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|