C16H16N2O — CID 88966080
(1E,4E,6Z)-6-[(Z)-2-aminoethenyl]-1-pyridin-4-ylnona-1,4,6,8-tetraen-3-one (PubChem CID 88966080) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is (1E,4E,6Z)-6-[(Z)-2-aminoethenyl]-1-pyridin-4-ylnona-1,4,6,8-tetraen-3-one.
| Compound Name | (1E,4E,6Z)-6-[(Z)-2-aminoethenyl]-1-pyridin-4-ylnona-1,4,6,8-tetraen-3-one |
|---|---|
| PubChem CID | 88966080 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (1E,4E,6Z)-6-[(Z)-2-aminoethenyl]-1-pyridin-4-ylnona-1,4,6,8-tetraen-3-one |
| SMILES | C=C/C=C(\C=C/N)/C=C/C(=O)/C=C/c1ccncc1 |
| InChI | InChI=1S/C16H16N2O/c1-2-3-14(8-11-17)4-6-16(19)7-5-15-9-12-18-13-10-15/h2-13H,1,17H2/b6-4+,7-5+,11-8-,14-3- |
| InChIKey | UZBDNPILKNCAJW-FHYLKTRHSA-N |
| XLogP | 2.80 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|