C35H30F8O5S — CID 88968690
[4-[4-(4-butan-2-yloxyphenyl)sulfonylphenoxy]-2,3,5,6-tetrafluorophenyl]-[2,3,5,6-tetrafluoro-4-(3-methylpentan-3-yl)phenyl]methanone (PubChem CID 88968690) has the molecular formula C35H30F8O5S and a molecular weight of 714.67 g/mol. Its IUPAC name is [4-[4-(4-butan-2-yloxyphenyl)sulfonylphenoxy]-2,3,5,6-tetrafluorophenyl]-[2,3,5,6-tetrafluoro-4-(3-methylpentan-3-yl)phenyl]methanone.
| Compound Name | [4-[4-(4-butan-2-yloxyphenyl)sulfonylphenoxy]-2,3,5,6-tetrafluorophenyl]-[2,3,5,6-tetrafluoro-4-(3-methylpentan-3-yl)phenyl]methanone |
|---|---|
| PubChem CID | 88968690 |
| Molecular Formula | C35H30F8O5S |
| Molecular Weight | 714.67 g/mol |
| Exact Mass | 714.17 |
| IUPAC Name | [4-[4-(4-butan-2-yloxyphenyl)sulfonylphenoxy]-2,3,5,6-tetrafluorophenyl]-[2,3,5,6-tetrafluoro-4-(3-methylpentan-3-yl)phenyl]methanone |
| SMILES | CCC(C)Oc1ccc(S(=O)(=O)c2ccc(Oc3c(F)c(F)c(C(=O)c4c(F)c(F)c(C(C)(CC)CC)c(F)c4F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C35H30F8O5S/c1-6-17(4)47-18-9-13-20(14-10-18)49(45,46)21-15-11-19(12-16-21)48-34-31(42)27(38)23(28(39)32(34)43)33(44)22-25(36)29(40)24(30(41)26(22)37)35(5,7-2)8-3/h9-17H,6-8H2,1-5H3 |
| InChIKey | XDAQBCPXWKGBHX-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.67 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|