C14H16BrN3O4 — CID 8896947
N'-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-cyclopropyloxamide (PubChem CID 8896947) has the molecular formula C14H16BrN3O4 and a molecular weight of 370.20 g/mol. Its IUPAC name is N'-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-cyclopropyloxamide.
| Compound Name | N'-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-cyclopropyloxamide |
|---|---|
| PubChem CID | 8896947 |
| Molecular Formula | C14H16BrN3O4 |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | N'-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-cyclopropyloxamide |
| SMILES | COc1cc(Br)c(/C=N\NC(=O)C(=O)NC2CC2)cc1OC |
| InChI | InChI=1S/C14H16BrN3O4/c1-21-11-5-8(10(15)6-12(11)22-2)7-16-18-14(20)13(19)17-9-3-4-9/h5-7,9H,3-4H2,1-2H3,(H,17,19)(H,18,20)/b16-7- |
| InChIKey | VMXFRGGLHRGDNB-APSNUPSMSA-N |
| XLogP | 1.20 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|