C22H21NO2S — CID 88970446
(1R,2S,3S,4R)-2-[3-(5-formylthiophen-2-yl)propyl]-4-hydroxy-3-(2-phenylethynyl)cyclopentane-1-carbonitrile (PubChem CID 88970446) has the molecular formula C22H21NO2S and a molecular weight of 363.48 g/mol. Its IUPAC name is (1R,2S,3S,4R)-2-[3-(5-formylthiophen-2-yl)propyl]-4-hydroxy-3-(2-phenylethynyl)cyclopentane-1-carbonitrile.
| Compound Name | (1R,2S,3S,4R)-2-[3-(5-formylthiophen-2-yl)propyl]-4-hydroxy-3-(2-phenylethynyl)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 88970446 |
| Molecular Formula | C22H21NO2S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (1R,2S,3S,4R)-2-[3-(5-formylthiophen-2-yl)propyl]-4-hydroxy-3-(2-phenylethynyl)cyclopentane-1-carbonitrile |
| SMILES | N#C[C@@H]1C[C@@H](O)[C@H](C#Cc2ccccc2)[C@H]1CCCc1ccc(C=O)s1 |
| InChI | InChI=1S/C22H21NO2S/c23-14-17-13-22(25)21(12-9-16-5-2-1-3-6-16)20(17)8-4-7-18-10-11-19(15-24)26-18/h1-3,5-6,10-11,15,17,20-22,25H,4,7-8,13H2/t17-,20-,21+,22+/m0/s1 |
| InChIKey | QYYHVIPUFBXKJY-GUGJDKNPSA-N |
| XLogP | 4.07 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|