C14H15N3O3S — CID 88972654
ethyl 1-phenyl-5-[(2-sulfanylacetyl)amino]imidazole-4-carboxylate (PubChem CID 88972654) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is ethyl 1-phenyl-5-[(2-sulfanylacetyl)amino]imidazole-4-carboxylate.
| Compound Name | ethyl 1-phenyl-5-[(2-sulfanylacetyl)amino]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 88972654 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | ethyl 1-phenyl-5-[(2-sulfanylacetyl)amino]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncn(-c2ccccc2)c1NC(=O)CS |
| InChI | InChI=1S/C14H15N3O3S/c1-2-20-14(19)12-13(16-11(18)8-21)17(9-15-12)10-6-4-3-5-7-10/h3-7,9,21H,2,8H2,1H3,(H,16,18) |
| InChIKey | GUQXHMMVUBIBOJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|