C14H23Cl3O8 — CID 88973228
(2R,4S,5S)-2-[[(2S,3R,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl]-5-chloro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 88973228) has the molecular formula C14H23Cl3O8 and a molecular weight of 425.69 g/mol. Its IUPAC name is (2R,4S,5S)-2-[[(2S,3R,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl]-5-chloro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,4S,5S)-2-[[(2S,3R,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl]-5-chloro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 88973228 |
| Molecular Formula | C14H23Cl3O8 |
| Molecular Weight | 425.69 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | (2R,4S,5S)-2-[[(2S,3R,5S)-2,5-bis(chloromethyl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl]-5-chloro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OCC1O[C@H](COC[C@]2(CCl)O[C@H](CCl)C(O)[C@H]2O)C(O)[C@H](O)[C@@H]1Cl |
| InChI | InChI=1S/C14H23Cl3O8/c15-1-6-11(20)13(22)14(4-16,25-6)5-23-3-8-10(19)12(21)9(17)7(2-18)24-8/h6-13,18-22H,1-5H2/t6-,7?,8-,9-,10?,11?,12-,13-,14+/m1/s1 |
| InChIKey | XXZDHIMUUXKXDC-UKHZKQGOSA-N |
| XLogP | -1.57 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.69 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|