C26H26ClN5O3S — CID 88974669
methyl (2S)-4-[2-[4-[4-[(6-chloro-1,3-benzothiazol-2-yl)amino]phenyl]-2-pyridinyl]hydrazinyl]-4-oxo-2-propan-2-ylbutanoate (PubChem CID 88974669) has the molecular formula C26H26ClN5O3S and a molecular weight of 524.05 g/mol. Its IUPAC name is methyl (2S)-4-[2-[4-[4-[(6-chloro-1,3-benzothiazol-2-yl)amino]phenyl]-2-pyridinyl]hydrazinyl]-4-oxo-2-propan-2-ylbutanoate.
| Compound Name | methyl (2S)-4-[2-[4-[4-[(6-chloro-1,3-benzothiazol-2-yl)amino]phenyl]-2-pyridinyl]hydrazinyl]-4-oxo-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 88974669 |
| Molecular Formula | C26H26ClN5O3S |
| Molecular Weight | 524.05 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | methyl (2S)-4-[2-[4-[4-[(6-chloro-1,3-benzothiazol-2-yl)amino]phenyl]-2-pyridinyl]hydrazinyl]-4-oxo-2-propan-2-ylbutanoate |
| SMILES | COC(=O)[C@@H](CC(=O)NNc1cc(-c2ccc(Nc3nc4ccc(Cl)cc4s3)cc2)ccn1)C(C)C |
| InChI | InChI=1S/C26H26ClN5O3S/c1-15(2)20(25(34)35-3)14-24(33)32-31-23-12-17(10-11-28-23)16-4-7-19(8-5-16)29-26-30-21-9-6-18(27)13-22(21)36-26/h4-13,15,20H,14H2,1-3H3,(H,28,31)(H,29,30)(H,32,33)/t20-/m0/s1 |
| InChIKey | PGKSDRIZSORULS-FQEVSTJZSA-N |
| XLogP | 6.03 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.05 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|