C27H23ClN4O2S — CID 88987987
2-(4-chlorophenyl)-3-[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-methyl-1,3-thiazole-5-carbonyl]-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one (PubChem CID 88987987) has the molecular formula C27H23ClN4O2S and a molecular weight of 503.03 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-methyl-1,3-thiazole-5-carbonyl]-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one.
| Compound Name | 2-(4-chlorophenyl)-3-[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-methyl-1,3-thiazole-5-carbonyl]-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
|---|---|
| PubChem CID | 88987987 |
| Molecular Formula | C27H23ClN4O2S |
| Molecular Weight | 503.03 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 2-(4-chlorophenyl)-3-[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-methyl-1,3-thiazole-5-carbonyl]-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
| SMILES | C=C/C=C\C=C(/C)c1nc(C)c(C(=O)N2CCN3C(=O)c4ccncc4C32c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C27H23ClN4O2S/c1-4-5-6-7-17(2)24-30-18(3)23(35-24)26(34)32-15-14-31-25(33)21-12-13-29-16-22(21)27(31,32)19-8-10-20(28)11-9-19/h4-13,16H,1,14-15H2,2-3H3/b6-5-,17-7+ |
| InChIKey | KBPYKQKBHVZDQN-IANWOCAHSA-N |
| XLogP | 5.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.03 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|