C11H12BrN — CID 88991378
2-[(1E)-2-bromobuta-1,3-dienyl]-4-methylaniline (PubChem CID 88991378) has the molecular formula C11H12BrN and a molecular weight of 238.13 g/mol. Its IUPAC name is 2-[(1E)-2-bromobuta-1,3-dienyl]-4-methylaniline.
| Compound Name | 2-[(1E)-2-bromobuta-1,3-dienyl]-4-methylaniline |
|---|---|
| PubChem CID | 88991378 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-[(1E)-2-bromobuta-1,3-dienyl]-4-methylaniline |
| SMILES | C=C/C(Br)=C\c1cc(C)ccc1N |
| InChI | InChI=1S/C11H12BrN/c1-3-10(12)7-9-6-8(2)4-5-11(9)13/h3-7H,1,13H2,2H3/b10-7+ |
| InChIKey | DPFBRDVSFXABGV-JXMROGBWSA-N |
| XLogP | 3.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|