C29H30FN3O — CID 88991516
2-[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluoroanilino]ethyl]-4-(2-phenylethynyl)benzaldehyde (PubChem CID 88991516) has the molecular formula C29H30FN3O and a molecular weight of 455.58 g/mol. Its IUPAC name is 2-[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluoroanilino]ethyl]-4-(2-phenylethynyl)benzaldehyde.
| Compound Name | 2-[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluoroanilino]ethyl]-4-(2-phenylethynyl)benzaldehyde |
|---|---|
| PubChem CID | 88991516 |
| Molecular Formula | C29H30FN3O |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 2-[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluoroanilino]ethyl]-4-(2-phenylethynyl)benzaldehyde |
| SMILES | CN(C)[C@@H]1CCN(c2ccc(NCCc3cc(C#Cc4ccccc4)ccc3C=O)cc2F)C1 |
| InChI | InChI=1S/C29H30FN3O/c1-32(2)27-15-17-33(20-27)29-13-12-26(19-28(29)30)31-16-14-24-18-23(10-11-25(24)21-34)9-8-22-6-4-3-5-7-22/h3-7,10-13,18-19,21,27,31H,14-17,20H2,1-2H3/t27-/m1/s1 |
| InChIKey | NYNYTBBIDBIKJT-HHHXNRCGSA-N |
| XLogP | 4.83 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|