C25H34FN3O2 — CID 89335384
4-butoxy-2-[2-[4-[3-(dimethylamino)pyrrolidin-1-yl]-3-fluoroanilino]ethyl]benzaldehyde (PubChem CID 89335384) has the molecular formula C25H34FN3O2 and a molecular weight of 427.56 g/mol. Its IUPAC name is 4-butoxy-2-[2-[4-[3-(dimethylamino)pyrrolidin-1-yl]-3-fluoroanilino]ethyl]benzaldehyde.
| Compound Name | 4-butoxy-2-[2-[4-[3-(dimethylamino)pyrrolidin-1-yl]-3-fluoroanilino]ethyl]benzaldehyde |
|---|---|
| PubChem CID | 89335384 |
| Molecular Formula | C25H34FN3O2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 4-butoxy-2-[2-[4-[3-(dimethylamino)pyrrolidin-1-yl]-3-fluoroanilino]ethyl]benzaldehyde |
| SMILES | CCCCOc1ccc(C=O)c(CCNc2ccc(N3CCC(N(C)C)C3)c(F)c2)c1 |
| InChI | InChI=1S/C25H34FN3O2/c1-4-5-14-31-23-8-6-20(18-30)19(15-23)10-12-27-21-7-9-25(24(26)16-21)29-13-11-22(17-29)28(2)3/h6-9,15-16,18,22,27H,4-5,10-14,17H2,1-3H3 |
| InChIKey | PXPFKZGJMMNERY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|