C27H36FN3O4S — CID 24859709
6-butoxy-2-[3-fluoro-4-[(3R)-3-[methyl(2-methylsulfonylethyl)amino]pyrrolidin-1-yl]phenyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 24859709) has the molecular formula C27H36FN3O4S and a molecular weight of 517.67 g/mol. Its IUPAC name is 6-butoxy-2-[3-fluoro-4-[(3R)-3-[methyl(2-methylsulfonylethyl)amino]pyrrolidin-1-yl]phenyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-butoxy-2-[3-fluoro-4-[(3R)-3-[methyl(2-methylsulfonylethyl)amino]pyrrolidin-1-yl]phenyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 24859709 |
| Molecular Formula | C27H36FN3O4S |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 6-butoxy-2-[3-fluoro-4-[(3R)-3-[methyl(2-methylsulfonylethyl)amino]pyrrolidin-1-yl]phenyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | CCCCOc1ccc2c(c1)CCN(c1ccc(N3CC[C@@H](N(C)CCS(C)(=O)=O)C3)c(F)c1)C2=O |
| InChI | InChI=1S/C27H36FN3O4S/c1-4-5-15-35-23-7-8-24-20(17-23)10-13-31(27(24)32)21-6-9-26(25(28)18-21)30-12-11-22(19-30)29(2)14-16-36(3,33)34/h6-9,17-18,22H,4-5,10-16,19H2,1-3H3/t22-/m1/s1 |
| InChIKey | KGDPYTRHDFHALX-JOCHJYFZSA-N |
| XLogP | 3.76 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|