C25H29FN2O2 — CID 70811307
2-[4-(3-ethylpyrrolidin-1-yl)-3-fluorophenyl]-6-[(E)-2-hydroxybut-1-enyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 70811307) has the molecular formula C25H29FN2O2 and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-[4-(3-ethylpyrrolidin-1-yl)-3-fluorophenyl]-6-[(E)-2-hydroxybut-1-enyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-[4-(3-ethylpyrrolidin-1-yl)-3-fluorophenyl]-6-[(E)-2-hydroxybut-1-enyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 70811307 |
| Molecular Formula | C25H29FN2O2 |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-[4-(3-ethylpyrrolidin-1-yl)-3-fluorophenyl]-6-[(E)-2-hydroxybut-1-enyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | CC/C(O)=C\c1ccc2c(c1)CCN(c1ccc(N3CCC(CC)C3)c(F)c1)C2=O |
| InChI | InChI=1S/C25H29FN2O2/c1-3-17-9-11-27(16-17)24-8-6-20(15-23(24)26)28-12-10-19-13-18(14-21(29)4-2)5-7-22(19)25(28)30/h5-8,13-15,17,29H,3-4,9-12,16H2,1-2H3/b21-14+ |
| InChIKey | RISIZQCHEARDQR-KGENOOAVSA-N |
| XLogP | 5.57 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|