C20H22FN2OP — CID 143525575
2-[3-fluoro-4-(3-methylpyrrolidin-1-yl)phenyl]-1-phosphanylidene-3,4-dihydroisoquinolin-6-ol (PubChem CID 143525575) has the molecular formula C20H22FN2OP and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-[3-fluoro-4-(3-methylpyrrolidin-1-yl)phenyl]-1-phosphanylidene-3,4-dihydroisoquinolin-6-ol.
| Compound Name | 2-[3-fluoro-4-(3-methylpyrrolidin-1-yl)phenyl]-1-phosphanylidene-3,4-dihydroisoquinolin-6-ol |
|---|---|
| PubChem CID | 143525575 |
| Molecular Formula | C20H22FN2OP |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[3-fluoro-4-(3-methylpyrrolidin-1-yl)phenyl]-1-phosphanylidene-3,4-dihydroisoquinolin-6-ol |
| SMILES | [H]/P=C1\c2ccc(O)cc2CCN1c1ccc(N2CCC(C)C2)c(F)c1 |
| InChI | InChI=1S/C20H22FN2OP/c1-13-6-8-22(12-13)19-5-2-15(11-18(19)21)23-9-7-14-10-16(24)3-4-17(14)20(23)25/h2-5,10-11,13,24-25H,6-9,12H2,1H3 |
| InChIKey | PGAWZRZKWZRWHU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|