C24H28FN3O — CID 70811405
6-cyclopropyl-2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 70811405) has the molecular formula C24H28FN3O and a molecular weight of 393.51 g/mol. Its IUPAC name is 6-cyclopropyl-2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-cyclopropyl-2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 70811405 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 6-cyclopropyl-2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | CN(C)[C@@H]1CCN(c2ccc(N3CCc4cc(C5CC5)ccc4C3=O)cc2F)C1 |
| InChI | InChI=1S/C24H28FN3O/c1-26(2)20-10-11-27(15-20)23-8-6-19(14-22(23)25)28-12-9-18-13-17(16-3-4-16)5-7-21(18)24(28)29/h5-8,13-14,16,20H,3-4,9-12,15H2,1-2H3/t20-/m1/s1 |
| InChIKey | ZZJFZAWCFNXLHY-HXUWFJFHSA-N |
| XLogP | 4.05 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|