C32H36Cl2FN3O4 — CID 161083747
2-(2-chloroethyl)-4-methoxybenzoyl chloride;2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-6-methoxy-3,4-dihydroisoquinolin-1-one (PubChem CID 161083747) has the molecular formula C32H36Cl2FN3O4 and a molecular weight of 616.56 g/mol. Its IUPAC name is 2-(2-chloroethyl)-4-methoxybenzoyl chloride;2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-6-methoxy-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-(2-chloroethyl)-4-methoxybenzoyl chloride;2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-6-methoxy-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 161083747 |
| Molecular Formula | C32H36Cl2FN3O4 |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 615.21 |
| IUPAC Name | 2-(2-chloroethyl)-4-methoxybenzoyl chloride;2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-6-methoxy-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1ccc(C(=O)Cl)c(CCCl)c1.COc1ccc2c(c1)CCN(c1ccc(N3CC[C@@H](N(C)C)C3)c(F)c1)C2=O |
| InChI | InChI=1S/C22H26FN3O2.C10H10Cl2O2/c1-24(2)17-9-10-25(14-17)21-7-4-16(13-20(21)23)26-11-8-15-12-18(28-3)5-6-19(15)22(26)27;1-14-8-2-3-9(10(12)13)7(6-8)4-5-11/h4-7,12-13,17H,8-11,14H2,1-3H3;2-3,6H,4-5H2,1H3/t17-;/m1./s1 |
| InChIKey | UGFWDNCUMPTCCH-UNTBIKODSA-N |
| XLogP | 6.03 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|