C17H23N3O3S — CID 89110136
5-[[2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-5-methoxyphenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 89110136) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 5-[[2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-5-methoxyphenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-5-methoxyphenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89110136 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 5-[[2-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-5-methoxyphenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(N2CC[C@H](N(C)C)C2)c(CC2SC(=O)NC2=O)c1 |
| InChI | InChI=1S/C17H23N3O3S/c1-19(2)12-6-7-20(10-12)14-5-4-13(23-3)8-11(14)9-15-16(21)18-17(22)24-15/h4-5,8,12,15H,6-7,9-10H2,1-3H3,(H,18,21,22)/t12-,15?/m0/s1 |
| InChIKey | SQZBKJVTWUKIPC-SFVWDYPZSA-N |
| XLogP | 1.73 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|