C25H30FN3O2 — CID 24859712
6-(cyclopropylmethoxy)-2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 24859712) has the molecular formula C25H30FN3O2 and a molecular weight of 423.53 g/mol. Its IUPAC name is 6-(cyclopropylmethoxy)-2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-(cyclopropylmethoxy)-2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 24859712 |
| Molecular Formula | C25H30FN3O2 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 6-(cyclopropylmethoxy)-2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | CN(C)[C@@H]1CCN(c2ccc(N3CCc4cc(OCC5CC5)ccc4C3=O)cc2F)C1 |
| InChI | InChI=1S/C25H30FN3O2/c1-27(2)20-10-11-28(15-20)24-8-5-19(14-23(24)26)29-12-9-18-13-21(31-16-17-3-4-17)6-7-22(18)25(29)30/h5-8,13-14,17,20H,3-4,9-12,15-16H2,1-2H3/t20-/m1/s1 |
| InChIKey | GFLHQOQTWACNPF-HXUWFJFHSA-N |
| XLogP | 3.96 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|