C28H35ClN2O3 — CID 143525850
6-butoxy-2-(3-chloro-4-hydroxyphenyl)-3,4-dihydroisoquinolin-1-one;2-methyl-2-azatricyclo[5.2.0.01,3]nonane (PubChem CID 143525850) has the molecular formula C28H35ClN2O3 and a molecular weight of 483.05 g/mol. Its IUPAC name is 6-butoxy-2-(3-chloro-4-hydroxyphenyl)-3,4-dihydroisoquinolin-1-one;2-methyl-2-azatricyclo[5.2.0.01,3]nonane.
| Compound Name | 6-butoxy-2-(3-chloro-4-hydroxyphenyl)-3,4-dihydroisoquinolin-1-one;2-methyl-2-azatricyclo[5.2.0.01,3]nonane |
|---|---|
| PubChem CID | 143525850 |
| Molecular Formula | C28H35ClN2O3 |
| Molecular Weight | 483.05 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 6-butoxy-2-(3-chloro-4-hydroxyphenyl)-3,4-dihydroisoquinolin-1-one;2-methyl-2-azatricyclo[5.2.0.01,3]nonane |
| SMILES | CCCCOc1ccc2c(c1)CCN(c1ccc(O)c(Cl)c1)C2=O.CN1C2CCCC3CCC321 |
| InChI | InChI=1S/C19H20ClNO3.C9H15N/c1-2-3-10-24-15-5-6-16-13(11-15)8-9-21(19(16)23)14-4-7-18(22)17(20)12-14;1-10-8-4-2-3-7-5-6-9(7,8)10/h4-7,11-12,22H,2-3,8-10H2,1H3;7-8H,2-6H2,1H3 |
| InChIKey | SUKKTXXFUOROJY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.05 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|