C25H25N5OS — CID 89010478
7-[1-(5-aminothiophen-2-yl)ethenylamino]-2-[[3-(2-iminopyrrolidin-1-yl)phenyl]methyl]-3H-isoindol-1-one (PubChem CID 89010478) has the molecular formula C25H25N5OS and a molecular weight of 443.58 g/mol. Its IUPAC name is 7-[1-(5-aminothiophen-2-yl)ethenylamino]-2-[[3-(2-iminopyrrolidin-1-yl)phenyl]methyl]-3H-isoindol-1-one.
| Compound Name | 7-[1-(5-aminothiophen-2-yl)ethenylamino]-2-[[3-(2-iminopyrrolidin-1-yl)phenyl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 89010478 |
| Molecular Formula | C25H25N5OS |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 7-[1-(5-aminothiophen-2-yl)ethenylamino]-2-[[3-(2-iminopyrrolidin-1-yl)phenyl]methyl]-3H-isoindol-1-one |
| SMILES | [H]/N=C1\CCCN1c1cccc(CN2Cc3cccc(NC(=C)c4ccc(N)s4)c3C2=O)c1 |
| InChI | InChI=1S/C25H25N5OS/c1-16(21-10-11-23(27)32-21)28-20-8-3-6-18-15-29(25(31)24(18)20)14-17-5-2-7-19(13-17)30-12-4-9-22(30)26/h2-3,5-8,10-11,13,26,28H,1,4,9,12,14-15,27H2/b26-22+ |
| InChIKey | NHJDVXCSTLJOPR-XTCLZLMSSA-N |
| XLogP | 5.15 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|