C23H43NO10S2 — CID 89016279
(3S,5S,6S)-5-[[(3S,5S,6S)-5-[(2R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-6-methyl-3-sulfanyloxyoctanoyl]amino]-6-methyl-3-sulfanyloxyoctanoic acid (PubChem CID 89016279) has the molecular formula C23H43NO10S2 and a molecular weight of 557.73 g/mol. Its IUPAC name is (3S,5S,6S)-5-[[(3S,5S,6S)-5-[(2R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-6-methyl-3-sulfanyloxyoctanoyl]amino]-6-methyl-3-sulfanyloxyoctanoic acid.
| Compound Name | (3S,5S,6S)-5-[[(3S,5S,6S)-5-[(2R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-6-methyl-3-sulfanyloxyoctanoyl]amino]-6-methyl-3-sulfanyloxyoctanoic acid |
|---|---|
| PubChem CID | 89016279 |
| Molecular Formula | C23H43NO10S2 |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | (3S,5S,6S)-5-[[(3S,5S,6S)-5-[(2R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-6-methyl-3-sulfanyloxyoctanoyl]amino]-6-methyl-3-sulfanyloxyoctanoic acid |
| SMILES | CC[C@H](C)[C@H](C[C@@H](CC(=O)O)OS)NC(=O)C[C@H](C[C@H](O[C@@H]1O[C@@H](CO)C(O)C1O)[C@@H](C)CC)OS |
| InChI | InChI=1S/C23H43NO10S2/c1-5-12(3)16(7-14(33-35)10-20(27)28)24-19(26)9-15(34-36)8-17(13(4)6-2)31-23-22(30)21(29)18(11-25)32-23/h12-18,21-23,25,29-30,35-36H,5-11H2,1-4H3,(H,24,26)(H,27,28)/t12-,13-,14-,15-,16-,17-,18-,21?,22?,23+/m0/s1 |
| InChIKey | FCIJNFNYVNFEBI-HJWFVOMESA-N |
| XLogP | 1.49 |
| TPSA | 164.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|