C25H23F3NO4S2+ — CID 89021688
2,6-bis[(E)-2-(4-methylsulfonylphenyl)ethenyl]-1-(2,2,2-trifluoroethyl)pyridin-1-ium (PubChem CID 89021688) has the molecular formula C25H23F3NO4S2+ and a molecular weight of 522.59 g/mol. Its IUPAC name is 2,6-bis[(E)-2-(4-methylsulfonylphenyl)ethenyl]-1-(2,2,2-trifluoroethyl)pyridin-1-ium.
| Compound Name | 2,6-bis[(E)-2-(4-methylsulfonylphenyl)ethenyl]-1-(2,2,2-trifluoroethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 89021688 |
| Molecular Formula | C25H23F3NO4S2+ |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 2,6-bis[(E)-2-(4-methylsulfonylphenyl)ethenyl]-1-(2,2,2-trifluoroethyl)pyridin-1-ium |
| SMILES | CS(=O)(=O)c1ccc(/C=C/c2cccc(/C=C/c3ccc(S(C)(=O)=O)cc3)[n+]2CC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H23F3NO4S2/c1-34(30,31)23-14-8-19(9-15-23)6-12-21-4-3-5-22(29(21)18-25(26,27)28)13-7-20-10-16-24(17-11-20)35(2,32)33/h3-17H,18H2,1-2H3/q+1/b12-6+,13-7+ |
| InChIKey | KCBJYWLIAPERAT-PWHKKFIBSA-N |
| XLogP | 4.68 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|