C19H26N2O4 — CID 89021824
N-[5-[(1R)-2-[[(2R,4Z,6E)-4-ethenyl-7-methoxyhepta-4,6-dien-2-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide (PubChem CID 89021824) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[5-[(1R)-2-[[(2R,4Z,6E)-4-ethenyl-7-methoxyhepta-4,6-dien-2-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide.
| Compound Name | N-[5-[(1R)-2-[[(2R,4Z,6E)-4-ethenyl-7-methoxyhepta-4,6-dien-2-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
|---|---|
| PubChem CID | 89021824 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-[5-[(1R)-2-[[(2R,4Z,6E)-4-ethenyl-7-methoxyhepta-4,6-dien-2-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
| SMILES | C=C/C(=C\C=C\OC)C[C@@H](C)NC[C@H](O)c1ccc(O)c(NC=O)c1 |
| InChI | InChI=1S/C19H26N2O4/c1-4-15(6-5-9-25-3)10-14(2)20-12-19(24)16-7-8-18(23)17(11-16)21-13-22/h4-9,11,13-14,19-20,23-24H,1,10,12H2,2-3H3,(H,21,22)/b9-5+,15-6+/t14-,19+/m1/s1 |
| InChIKey | GAMRNDVKRTYFLF-SWFNZGFPSA-N |
| XLogP | 2.63 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|