C14H30NO5+ — CID 89022573
2-(2,2-dimethylbutanoyloxy)ethyl-dimethyl-(2,4,4-trihydroxybutyl)azanium (PubChem CID 89022573) has the molecular formula C14H30NO5+ and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl-dimethyl-(2,4,4-trihydroxybutyl)azanium.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl-dimethyl-(2,4,4-trihydroxybutyl)azanium |
|---|---|
| PubChem CID | 89022573 |
| Molecular Formula | C14H30NO5+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl-dimethyl-(2,4,4-trihydroxybutyl)azanium |
| SMILES | CCC(C)(C)C(=O)OCC[N+](C)(C)CC(O)CC(O)O |
| InChI | InChI=1S/C14H30NO5/c1-6-14(2,3)13(19)20-8-7-15(4,5)10-11(16)9-12(17)18/h11-12,16-18H,6-10H2,1-5H3/q+1 |
| InChIKey | KQCWGTIBEYOKHR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|