C12H10FN3O4 — CID 89022728
4-fluoro-N-(2-hydroxyethyl)-3-oxaldehydoyl-1H-pyrrolo[2,3-c]pyridine-7-carboxamide (PubChem CID 89022728) has the molecular formula C12H10FN3O4 and a molecular weight of 279.23 g/mol. Its IUPAC name is 4-fluoro-N-(2-hydroxyethyl)-3-oxaldehydoyl-1H-pyrrolo[2,3-c]pyridine-7-carboxamide.
| Compound Name | 4-fluoro-N-(2-hydroxyethyl)-3-oxaldehydoyl-1H-pyrrolo[2,3-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 89022728 |
| Molecular Formula | C12H10FN3O4 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 4-fluoro-N-(2-hydroxyethyl)-3-oxaldehydoyl-1H-pyrrolo[2,3-c]pyridine-7-carboxamide |
| SMILES | O=CC(=O)c1c[nH]c2c(C(=O)NCCO)ncc(F)c12 |
| InChI | InChI=1S/C12H10FN3O4/c13-7-4-16-11(12(20)14-1-2-17)10-9(7)6(3-15-10)8(19)5-18/h3-5,15,17H,1-2H2,(H,14,20) |
| InChIKey | SIMXJXVDZYAFFE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|