C9H4ClFN2O3 — CID 91514755
(7-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl) 2-oxoacetate (PubChem CID 91514755) has the molecular formula C9H4ClFN2O3 and a molecular weight of 242.59 g/mol. Its IUPAC name is (7-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl) 2-oxoacetate.
| Compound Name | (7-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl) 2-oxoacetate |
|---|---|
| PubChem CID | 91514755 |
| Molecular Formula | C9H4ClFN2O3 |
| Molecular Weight | 242.59 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | (7-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl) 2-oxoacetate |
| SMILES | O=CC(=O)Oc1c[nH]c2c(Cl)ncc(F)c12 |
| InChI | InChI=1S/C9H4ClFN2O3/c10-9-8-7(4(11)1-13-9)5(2-12-8)16-6(15)3-14/h1-3,12H |
| InChIKey | CFPTZCKZSSKMIH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.59 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|