C33H35F6N5O3S — CID 89025292
1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propane-1-thione (PubChem CID 89025292) has the molecular formula C33H35F6N5O3S and a molecular weight of 695.73 g/mol. Its IUPAC name is 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propane-1-thione.
| Compound Name | 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propane-1-thione |
|---|---|
| PubChem CID | 89025292 |
| Molecular Formula | C33H35F6N5O3S |
| Molecular Weight | 695.73 g/mol |
| Exact Mass | 695.24 |
| IUPAC Name | 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propane-1-thione |
| SMILES | O=[N+]([O-])c1ccc(NC2CCN(C(=S)CCN3CCN(c4ccc(OCc5ccc(C(F)(F)F)cc5)cc4)CC3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C33H35F6N5O3S/c34-32(35,36)24-3-1-23(2-4-24)22-47-28-8-6-27(7-9-28)42-19-17-41(18-20-42)14-13-31(48)43-15-11-25(12-16-43)40-26-5-10-30(44(45)46)29(21-26)33(37,38)39/h1-10,21,25,40H,11-20,22H2 |
| InChIKey | HZXKYVXXNPIFHE-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 74.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.73 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|