C23H19F3N2OS — CID 89033385
1-[4-(4-methylphenoxy)phenyl]-5-[3-(trifluoromethyl)phenyl]imidazolidine-2-thione (PubChem CID 89033385) has the molecular formula C23H19F3N2OS and a molecular weight of 428.48 g/mol. Its IUPAC name is 1-[4-(4-methylphenoxy)phenyl]-5-[3-(trifluoromethyl)phenyl]imidazolidine-2-thione.
| Compound Name | 1-[4-(4-methylphenoxy)phenyl]-5-[3-(trifluoromethyl)phenyl]imidazolidine-2-thione |
|---|---|
| PubChem CID | 89033385 |
| Molecular Formula | C23H19F3N2OS |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-[4-(4-methylphenoxy)phenyl]-5-[3-(trifluoromethyl)phenyl]imidazolidine-2-thione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=S)NCC3c3cccc(C(F)(F)F)c3)cc2)cc1 |
| InChI | InChI=1S/C23H19F3N2OS/c1-15-5-9-19(10-6-15)29-20-11-7-18(8-12-20)28-21(14-27-22(28)30)16-3-2-4-17(13-16)23(24,25)26/h2-13,21H,14H2,1H3,(H,27,30) |
| InChIKey | CWTPSFKKHAVGKJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|