C28H37N3O3 — CID 89045776
ethyl 2-[2-[2,6-dimethyl-4-[5-[1-(2,4,4-trimethylcyclohexen-1-yl)propa-1,2-dienyl]-1,2,4-oxadiazol-3-yl]phenyl]ethylamino]acetate (PubChem CID 89045776) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is ethyl 2-[2-[2,6-dimethyl-4-[5-[1-(2,4,4-trimethylcyclohexen-1-yl)propa-1,2-dienyl]-1,2,4-oxadiazol-3-yl]phenyl]ethylamino]acetate.
| Compound Name | ethyl 2-[2-[2,6-dimethyl-4-[5-[1-(2,4,4-trimethylcyclohexen-1-yl)propa-1,2-dienyl]-1,2,4-oxadiazol-3-yl]phenyl]ethylamino]acetate |
|---|---|
| PubChem CID | 89045776 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | ethyl 2-[2-[2,6-dimethyl-4-[5-[1-(2,4,4-trimethylcyclohexen-1-yl)propa-1,2-dienyl]-1,2,4-oxadiazol-3-yl]phenyl]ethylamino]acetate |
| SMILES | C=C=C(C1=C(C)CC(C)(C)CC1)c1nc(-c2cc(C)c(CCNCC(=O)OCC)c(C)c2)no1 |
| InChI | InChI=1S/C28H37N3O3/c1-8-22(24-10-12-28(6,7)16-20(24)5)27-30-26(31-34-27)21-14-18(3)23(19(4)15-21)11-13-29-17-25(32)33-9-2/h14-15,29H,1,9-13,16-17H2,2-7H3 |
| InChIKey | PHRBSIWHLCWLSQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|