C19H15N3O4S — CID 89047387
2-(4-aminophenoxy)-N-(1,3-benzoxazol-2-yl)benzenesulfonamide (PubChem CID 89047387) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-(4-aminophenoxy)-N-(1,3-benzoxazol-2-yl)benzenesulfonamide.
| Compound Name | 2-(4-aminophenoxy)-N-(1,3-benzoxazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 89047387 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-(4-aminophenoxy)-N-(1,3-benzoxazol-2-yl)benzenesulfonamide |
| SMILES | Nc1ccc(Oc2ccccc2S(=O)(=O)Nc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C19H15N3O4S/c20-13-9-11-14(12-10-13)25-17-7-3-4-8-18(17)27(23,24)22-19-21-15-5-1-2-6-16(15)26-19/h1-12H,20H2,(H,21,22) |
| InChIKey | MONOMSYYQUKHJN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|