C16H32O2 — CID 89049285
3-butyl-3-(4,5-dimethylnonan-5-yl)dioxirane (PubChem CID 89049285) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 3-butyl-3-(4,5-dimethylnonan-5-yl)dioxirane.
| Compound Name | 3-butyl-3-(4,5-dimethylnonan-5-yl)dioxirane |
|---|---|
| PubChem CID | 89049285 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 3-butyl-3-(4,5-dimethylnonan-5-yl)dioxirane |
| SMILES | CCCCC1(C(C)(CCCC)C(C)CCC)OO1 |
| InChI | InChI=1S/C16H32O2/c1-6-9-12-15(5,14(4)11-8-3)16(17-18-16)13-10-7-2/h14H,6-13H2,1-5H3 |
| InChIKey | LQUOJEXNNWRACV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|