C19H30N3O4+ — CID 8905371
[2-(4-butylanilino)-2-oxoethyl]-[2-(ethoxycarbonylamino)-2-oxoethyl]-ethylazanium (PubChem CID 8905371) has the molecular formula C19H30N3O4+ and a molecular weight of 364.47 g/mol. Its IUPAC name is [2-(4-butylanilino)-2-oxoethyl]-[2-(ethoxycarbonylamino)-2-oxoethyl]-ethylazanium.
| Compound Name | [2-(4-butylanilino)-2-oxoethyl]-[2-(ethoxycarbonylamino)-2-oxoethyl]-ethylazanium |
|---|---|
| PubChem CID | 8905371 |
| Molecular Formula | C19H30N3O4+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [2-(4-butylanilino)-2-oxoethyl]-[2-(ethoxycarbonylamino)-2-oxoethyl]-ethylazanium |
| SMILES | CCCCc1ccc(NC(=O)C[NH+](CC)CC(=O)NC(=O)OCC)cc1 |
| InChI | InChI=1S/C19H29N3O4/c1-4-7-8-15-9-11-16(12-10-15)20-17(23)13-22(5-2)14-18(24)21-19(25)26-6-3/h9-12H,4-8,13-14H2,1-3H3,(H,20,23)(H,21,24,25)/p+1 |
| InChIKey | JGZZGNXMFDWJBW-UHFFFAOYSA-O |
| XLogP | 1.15 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |