C14H21N2O6+ — CID 9038677
[2-(ethoxycarbonylamino)-2-oxoethyl]-ethyl-[(5-methoxycarbonylfuran-2-yl)methyl]azanium (PubChem CID 9038677) has the molecular formula C14H21N2O6+ and a molecular weight of 313.33 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl]-ethyl-[(5-methoxycarbonylfuran-2-yl)methyl]azanium.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl]-ethyl-[(5-methoxycarbonylfuran-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9038677 |
| Molecular Formula | C14H21N2O6+ |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl]-ethyl-[(5-methoxycarbonylfuran-2-yl)methyl]azanium |
| SMILES | CCOC(=O)NC(=O)C[NH+](CC)Cc1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C14H20N2O6/c1-4-16(9-12(17)15-14(19)21-5-2)8-10-6-7-11(22-10)13(18)20-3/h6-7H,4-5,8-9H2,1-3H3,(H,15,17,19)/p+1 |
| InChIKey | PXPAAILRXYEIER-UHFFFAOYSA-O |
| XLogP | -0.26 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |