C22H50N10O3 — CID 89061580
N-(2-aminoethyl)-3-[2-[[3-(2-aminoethylamino)-3-oxopropyl]-[3-(aminomethylamino)but-3-enyl]amino]ethyl-[3-(2-aminoethylamino)oxypropyl]amino]propanamide (PubChem CID 89061580) has the molecular formula C22H50N10O3 and a molecular weight of 502.71 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-[2-[[3-(2-aminoethylamino)-3-oxopropyl]-[3-(aminomethylamino)but-3-enyl]amino]ethyl-[3-(2-aminoethylamino)oxypropyl]amino]propanamide.
| Compound Name | N-(2-aminoethyl)-3-[2-[[3-(2-aminoethylamino)-3-oxopropyl]-[3-(aminomethylamino)but-3-enyl]amino]ethyl-[3-(2-aminoethylamino)oxypropyl]amino]propanamide |
|---|---|
| PubChem CID | 89061580 |
| Molecular Formula | C22H50N10O3 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.41 |
| IUPAC Name | N-(2-aminoethyl)-3-[2-[[3-(2-aminoethylamino)-3-oxopropyl]-[3-(aminomethylamino)but-3-enyl]amino]ethyl-[3-(2-aminoethylamino)oxypropyl]amino]propanamide |
| SMILES | C=C(CCN(CCC(=O)NCCN)CCN(CCCONCCN)CCC(=O)NCCN)NCN |
| InChI | InChI=1S/C22H50N10O3/c1-20(29-19-26)3-13-32(15-5-22(34)28-10-7-24)17-16-31(12-2-18-35-30-11-8-25)14-4-21(33)27-9-6-23/h29-30H,1-19,23-26H2,(H,27,33)(H,28,34) |
| InChIKey | PEIPIFUDYHPDLI-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 202.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|