C20H34O5SSi — CID 89062282
[(2R,3S,5R)-2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-5-methyloxan-3-yl] 4-methylbenzenesulfonate (PubChem CID 89062282) has the molecular formula C20H34O5SSi and a molecular weight of 414.64 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-5-methyloxan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,5R)-2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-5-methyloxan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89062282 |
| Molecular Formula | C20H34O5SSi |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | [(2R,3S,5R)-2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-5-methyloxan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C[C@@H](C)CO[C@@H]2CCC(C)(C)[Si](C)(C)O)cc1 |
| InChI | InChI=1S/C20H34O5SSi/c1-15-7-9-17(10-8-15)26(21,22)25-19-13-16(2)14-24-18(19)11-12-20(3,4)27(5,6)23/h7-10,16,18-19,23H,11-14H2,1-6H3/t16-,18-,19+/m1/s1 |
| InChIKey | GULCSBQQMBEBCI-QRQLOZEOSA-N |
| XLogP | 4.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|